C26H33N5O5 — CID 156792138
N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 156792138) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 156792138 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]hexyl]-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CC(C)n1cc(C(=O)NCCCCCCOc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cn1 |
| InChI | InChI=1S/C26H33N5O5/c1-17(2)31-16-19(14-28-31)24(33)27-11-5-3-4-6-12-36-20-7-8-21-18(13-20)15-30(26(21)35)22-9-10-23(32)29-25(22)34/h7-8,13-14,16-17,22H,3-6,9-12,15H2,1-2H3,(H,27,33)(H,29,32,34) |
| InChIKey | CULPORPNFQRERI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|