C25H39N3O6 — CID 171072812
ethane;3-[6-[4-(methylamino)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2-methylpropyl formate (PubChem CID 171072812) has the molecular formula C25H39N3O6 and a molecular weight of 477.60 g/mol. Its IUPAC name is ethane;3-[6-[4-(methylamino)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2-methylpropyl formate.
| Compound Name | ethane;3-[6-[4-(methylamino)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2-methylpropyl formate |
|---|---|
| PubChem CID | 171072812 |
| Molecular Formula | C25H39N3O6 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | ethane;3-[6-[4-(methylamino)butoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2-methylpropyl formate |
| SMILES | CC.CC(C)COC=O.CNCCCCOc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H23N3O4.C5H10O2.C2H6/c1-19-8-2-3-9-25-13-4-5-14-12(10-13)11-21(18(14)24)15-6-7-16(22)20-17(15)23;1-5(2)3-7-4-6;1-2/h4-5,10,15,19H,2-3,6-9,11H2,1H3,(H,20,22,23);4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | TUOJGNVQVOIOGB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|