C26H29N3O6 — CID 156512176
benzyl N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]pentyl]carbamate (PubChem CID 156512176) has the molecular formula C26H29N3O6 and a molecular weight of 479.53 g/mol. Its IUPAC name is benzyl N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]pentyl]carbamate.
| Compound Name | benzyl N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]pentyl]carbamate |
|---|---|
| PubChem CID | 156512176 |
| Molecular Formula | C26H29N3O6 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | benzyl N-[5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]pentyl]carbamate |
| SMILES | O=C1CCC(N2Cc3cc(OCCCCCNC(=O)OCc4ccccc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H29N3O6/c30-23-12-11-22(24(31)28-23)29-16-19-15-20(9-10-21(19)25(29)32)34-14-6-2-5-13-27-26(33)35-17-18-7-3-1-4-8-18/h1,3-4,7-10,15,22H,2,5-6,11-14,16-17H2,(H,27,33)(H,28,30,31) |
| InChIKey | FYJHBMMVVNMITC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|