C29H33N3O5 — CID 149285797
3-[3-oxo-6-[(1S,2R)-2-(3-phenylmethoxyazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 149285797) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1S,2R)-2-(3-phenylmethoxyazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1S,2R)-2-(3-phenylmethoxyazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 149285797 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 3-[3-oxo-6-[(1S,2R)-2-(3-phenylmethoxyazetidin-1-yl)cyclohexyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCCC[C@H]4N4CC(OCc5ccccc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H33N3O5/c33-27-13-12-25(28(34)30-27)32-15-20-14-21(10-11-23(20)29(32)35)37-26-9-5-4-8-24(26)31-16-22(17-31)36-18-19-6-2-1-3-7-19/h1-3,6-7,10-11,14,22,24-26H,4-5,8-9,12-13,15-18H2,(H,30,33,34)/t24-,25?,26+/m1/s1 |
| InChIKey | XTWAKTOROMGEKN-ITNFAHLUSA-N |
| XLogP | 3.04 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|