C23H26F3N3O5 — CID 146296769
3-[3-oxo-6-[2-[3-(2,2,2-trifluoroethoxy)azetidin-1-yl]cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146296769) has the molecular formula C23H26F3N3O5 and a molecular weight of 481.47 g/mol. Its IUPAC name is 3-[3-oxo-6-[2-[3-(2,2,2-trifluoroethoxy)azetidin-1-yl]cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[2-[3-(2,2,2-trifluoroethoxy)azetidin-1-yl]cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146296769 |
| Molecular Formula | C23H26F3N3O5 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-[3-oxo-6-[2-[3-(2,2,2-trifluoroethoxy)azetidin-1-yl]cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC4CCCC4N4CC(OCC(F)(F)F)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H26F3N3O5/c24-23(25,26)12-33-15-10-28(11-15)17-2-1-3-19(17)34-14-4-5-16-13(8-14)9-29(22(16)32)18-6-7-20(30)27-21(18)31/h4-5,8,15,17-19H,1-3,6-7,9-12H2,(H,27,30,31) |
| InChIKey | ARYONFGPBRIDPB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|