C24H31N3O5 — CID 147586748
3-[3-oxo-6-[(1R,2R)-2-(3-propan-2-yloxyazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 147586748) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1R,2R)-2-(3-propan-2-yloxyazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1R,2R)-2-(3-propan-2-yloxyazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147586748 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3-[3-oxo-6-[(1R,2R)-2-(3-propan-2-yloxyazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)OC1CN([C@@H]2CCC[C@H]2Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C24H31N3O5/c1-14(2)31-17-12-26(13-17)19-4-3-5-21(19)32-16-6-7-18-15(10-16)11-27(24(18)30)20-8-9-22(28)25-23(20)29/h6-7,10,14,17,19-21H,3-5,8-9,11-13H2,1-2H3,(H,25,28,29)/t19-,20?,21-/m1/s1 |
| InChIKey | FXMGXCCOFAPGPH-GIBKCMNESA-N |
| XLogP | 1.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|