C27H35F2N3O5 — CID 147565010
3-[6-[(1R,2S)-2-[3-(1,5-difluoropentan-3-yloxy)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 147565010) has the molecular formula C27H35F2N3O5 and a molecular weight of 519.59 g/mol. Its IUPAC name is 3-[6-[(1R,2S)-2-[3-(1,5-difluoropentan-3-yloxy)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1R,2S)-2-[3-(1,5-difluoropentan-3-yloxy)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147565010 |
| Molecular Formula | C27H35F2N3O5 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 3-[6-[(1R,2S)-2-[3-(1,5-difluoropentan-3-yloxy)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@@H]4N4CC(OC(CCF)CCF)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H35F2N3O5/c28-11-9-18(10-12-29)36-20-15-31(16-20)22-3-1-2-4-24(22)37-19-5-6-21-17(13-19)14-32(27(21)35)23-7-8-25(33)30-26(23)34/h5-6,13,18,20,22-24H,1-4,7-12,14-16H2,(H,30,33,34)/t22-,23?,24+/m0/s1 |
| InChIKey | FTJUFKWNTRDMGU-LIDAZEJRSA-N |
| XLogP | 2.93 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|