C38H33N3O6S — CID 165087302
3-[6-[5-[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]phenyl]-4-oxopentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165087302) has the molecular formula C38H33N3O6S and a molecular weight of 659.76 g/mol. Its IUPAC name is 3-[6-[5-[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]phenyl]-4-oxopentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[5-[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]phenyl]-4-oxopentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165087302 |
| Molecular Formula | C38H33N3O6S |
| Molecular Weight | 659.76 g/mol |
| Exact Mass | 659.21 |
| IUPAC Name | 3-[6-[5-[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]phenyl]-4-oxopentoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc2nc(-c3ccc(-c4ccc(CC(=O)CCCOc5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C38H33N3O6S/c1-46-29-13-15-32-34(21-29)48-37(39-32)26-10-8-25(9-11-26)24-6-4-23(5-7-24)19-28(42)3-2-18-47-30-12-14-31-27(20-30)22-41(38(31)45)33-16-17-35(43)40-36(33)44/h4-15,20-21,33H,2-3,16-19,22H2,1H3,(H,40,43,44) |
| InChIKey | KXAWNBQUXNCRHY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.76 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|