C38H35N5O6S — CID 164995968
2-[1-[2-[3-[5-[4-[6-(dimethylamino)-1,3-benzothiazol-2-yl]phenyl]-2-pyridinyl]propoxy]ethyl]-2,6-dioxopiperidin-3-yl]-5-hydroxyisoindole-1,3-dione (PubChem CID 164995968) has the molecular formula C38H35N5O6S and a molecular weight of 689.79 g/mol. Its IUPAC name is 2-[1-[2-[3-[5-[4-[6-(dimethylamino)-1,3-benzothiazol-2-yl]phenyl]-2-pyridinyl]propoxy]ethyl]-2,6-dioxopiperidin-3-yl]-5-hydroxyisoindole-1,3-dione.
| Compound Name | 2-[1-[2-[3-[5-[4-[6-(dimethylamino)-1,3-benzothiazol-2-yl]phenyl]-2-pyridinyl]propoxy]ethyl]-2,6-dioxopiperidin-3-yl]-5-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 164995968 |
| Molecular Formula | C38H35N5O6S |
| Molecular Weight | 689.79 g/mol |
| Exact Mass | 689.23 |
| IUPAC Name | 2-[1-[2-[3-[5-[4-[6-(dimethylamino)-1,3-benzothiazol-2-yl]phenyl]-2-pyridinyl]propoxy]ethyl]-2,6-dioxopiperidin-3-yl]-5-hydroxyisoindole-1,3-dione |
| SMILES | CN(C)c1ccc2nc(-c3ccc(-c4ccc(CCCOCCN5C(=O)CCC(N6C(=O)c7ccc(O)cc7C6=O)C5=O)nc4)cc3)sc2c1 |
| InChI | InChI=1S/C38H35N5O6S/c1-41(2)27-11-14-31-33(20-27)50-35(40-31)24-7-5-23(6-8-24)25-9-10-26(39-22-25)4-3-18-49-19-17-42-34(45)16-15-32(38(42)48)43-36(46)29-13-12-28(44)21-30(29)37(43)47/h5-14,20-22,32,44H,3-4,15-19H2,1-2H3 |
| InChIKey | JOURBCVKZQXBRT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.79 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|