C36H37N5O10S — CID 162522047
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 162522047) has the molecular formula C36H37N5O10S and a molecular weight of 731.78 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 162522047 |
| Molecular Formula | C36H37N5O10S |
| Molecular Weight | 731.78 g/mol |
| Exact Mass | 731.23 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)NCCOCCOCCOCCNc1ccc(-c2nc3ccc(O)cc3s2)cc1 |
| InChI | InChI=1S/C36H37N5O10S/c42-24-8-9-26-29(20-24)52-34(39-26)22-4-6-23(7-5-22)37-12-14-48-16-18-50-19-17-49-15-13-38-31(44)21-51-28-3-1-2-25-32(28)36(47)41(35(25)46)27-10-11-30(43)40-33(27)45/h1-9,20,27,37,42H,10-19,21H2,(H,38,44)(H,40,43,45) |
| InChIKey | GYYBDHVZZWWBHC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 194.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|