C31H38N4O5S — CID 175375128
butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate (PubChem CID 175375128) has the molecular formula C31H38N4O5S and a molecular weight of 578.74 g/mol. Its IUPAC name is butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate.
| Compound Name | butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 175375128 |
| Molecular Formula | C31H38N4O5S |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-[1-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate |
| SMILES | CCCCOC(=O)N(c1ccc2nc(-c3ccc(-c4ccc(N(C)C)nc4)cc3)sc2c1)C(C)OCCOCCO |
| InChI | InChI=1S/C31H38N4O5S/c1-5-6-16-40-31(37)35(22(2)39-19-18-38-17-15-36)26-12-13-27-28(20-26)41-30(33-27)24-9-7-23(8-10-24)25-11-14-29(32-21-25)34(3)4/h7-14,20-22,36H,5-6,15-19H2,1-4H3 |
| InChIKey | DLTZJKNPDISZCH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|