C32H42N4O3S — CID 166127118
tert-butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-(2-propoxyethyl)carbamate;ethane (PubChem CID 166127118) has the molecular formula C32H42N4O3S and a molecular weight of 562.78 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-(2-propoxyethyl)carbamate;ethane.
| Compound Name | tert-butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-(2-propoxyethyl)carbamate;ethane |
|---|---|
| PubChem CID | 166127118 |
| Molecular Formula | C32H42N4O3S |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | tert-butyl N-[2-[4-[6-(dimethylamino)-3-pyridinyl]phenyl]-1,3-benzothiazol-6-yl]-N-(2-propoxyethyl)carbamate;ethane |
| SMILES | CC.CCCOCCN(C(=O)OC(C)(C)C)c1ccc2nc(-c3ccc(-c4ccc(N(C)C)nc4)cc3)sc2c1 |
| InChI | InChI=1S/C30H36N4O3S.C2H6/c1-7-17-36-18-16-34(29(35)37-30(2,3)4)24-13-14-25-26(19-24)38-28(32-25)22-10-8-21(9-11-22)23-12-15-27(31-20-23)33(5)6;1-2/h8-15,19-20H,7,16-18H2,1-6H3;1-2H3 |
| InChIKey | OEHDQZXIQICIET-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|