C25H32N2O3S — CID 155151124
tert-butyl N-[4-[6-(1-butoxyethyl)-1,3-benzothiazol-2-yl]phenyl]-N-methylcarbamate (PubChem CID 155151124) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is tert-butyl N-[4-[6-(1-butoxyethyl)-1,3-benzothiazol-2-yl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[6-(1-butoxyethyl)-1,3-benzothiazol-2-yl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155151124 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | tert-butyl N-[4-[6-(1-butoxyethyl)-1,3-benzothiazol-2-yl]phenyl]-N-methylcarbamate |
| SMILES | CCCCOC(C)c1ccc2nc(-c3ccc(N(C)C(=O)OC(C)(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C25H32N2O3S/c1-7-8-15-29-17(2)19-11-14-21-22(16-19)31-23(26-21)18-9-12-20(13-10-18)27(6)24(28)30-25(3,4)5/h9-14,16-17H,7-8,15H2,1-6H3 |
| InChIKey | AWTNWAPIWAGLQE-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|