C20H21IN2O3S — CID 132943126
tert-butyl N-[2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-N-methylcarbamate (PubChem CID 132943126) has the molecular formula C20H21IN2O3S and a molecular weight of 496.37 g/mol. Its IUPAC name is tert-butyl N-[2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 132943126 |
| Molecular Formula | C20H21IN2O3S |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | tert-butyl N-[2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]-N-methylcarbamate |
| SMILES | COc1ccc2nc(-c3ccc(N(C)C(=O)OC(C)(C)C)c(I)c3)sc2c1 |
| InChI | InChI=1S/C20H21IN2O3S/c1-20(2,3)26-19(24)23(4)16-9-6-12(10-14(16)21)18-22-15-8-7-13(25-5)11-17(15)27-18/h6-11H,1-5H3 |
| InChIKey | FTKFEPSRRMCCIW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|