C19H19FN2O3S — CID 89368029
N-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-2-(18F)fluorophenyl]-N-methylacetamide (PubChem CID 89368029) has the molecular formula C19H19FN2O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is N-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-2-(18F)fluorophenyl]-N-methylacetamide.
| Compound Name | N-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-2-(18F)fluorophenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 89368029 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-2-(18F)fluorophenyl]-N-methylacetamide |
| SMILES | CCOCOc1ccc2nc(-c3ccc(N(C)C(C)=O)c([18F])c3)sc2c1 |
| InChI | InChI=1S/C19H19FN2O3S/c1-4-24-11-25-14-6-7-16-18(10-14)26-19(21-16)13-5-8-17(15(20)9-13)22(3)12(2)23/h5-10H,4,11H2,1-3H3/i20-1 |
| InChIKey | AZVVZLXGMQRDEI-LRFGSCOBSA-N |
| XLogP | 4.46 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|