C25H28N4O6S — CID 123516006
tert-butyl N-[5-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]buta-1,3-dienyl]-6-nitro-2-pyridinyl]-N-methylcarbamate (PubChem CID 123516006) has the molecular formula C25H28N4O6S and a molecular weight of 512.59 g/mol. Its IUPAC name is tert-butyl N-[5-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]buta-1,3-dienyl]-6-nitro-2-pyridinyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[5-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]buta-1,3-dienyl]-6-nitro-2-pyridinyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123516006 |
| Molecular Formula | C25H28N4O6S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | tert-butyl N-[5-[4-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]buta-1,3-dienyl]-6-nitro-2-pyridinyl]-N-methylcarbamate |
| SMILES | CCOCOc1ccc2nc(C=CC=Cc3ccc(N(C)C(=O)OC(C)(C)C)nc3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C25H28N4O6S/c1-6-33-16-34-18-12-13-19-20(15-18)36-22(26-19)10-8-7-9-17-11-14-21(27-23(17)29(31)32)28(5)24(30)35-25(2,3)4/h7-15H,6,16H2,1-5H3 |
| InChIKey | GOKIGXYZVNSCSV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|