C13H20N2O2 — CID 58695834
tert-butyl N-(6-ethyl-2-pyridinyl)-N-methylcarbamate (PubChem CID 58695834) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is tert-butyl N-(6-ethyl-2-pyridinyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(6-ethyl-2-pyridinyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 58695834 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | tert-butyl N-(6-ethyl-2-pyridinyl)-N-methylcarbamate |
| SMILES | CCc1cccc(N(C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C13H20N2O2/c1-6-10-8-7-9-11(14-10)15(5)12(16)17-13(2,3)4/h7-9H,6H2,1-5H3 |
| InChIKey | DCGCVOFQAGXVEN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |