C36H39BrN4O6 — CID 161252198
tert-butyl N-benzoyl-N-[6-(bromomethyl)-2-pyridinyl]carbamate;tert-butyl N-benzoyl-N-(6-methyl-2-pyridinyl)carbamate (PubChem CID 161252198) has the molecular formula C36H39BrN4O6 and a molecular weight of 703.63 g/mol. Its IUPAC name is tert-butyl N-benzoyl-N-[6-(bromomethyl)-2-pyridinyl]carbamate;tert-butyl N-benzoyl-N-(6-methyl-2-pyridinyl)carbamate.
| Compound Name | tert-butyl N-benzoyl-N-[6-(bromomethyl)-2-pyridinyl]carbamate;tert-butyl N-benzoyl-N-(6-methyl-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 161252198 |
| Molecular Formula | C36H39BrN4O6 |
| Molecular Weight | 703.63 g/mol |
| Exact Mass | 702.21 |
| IUPAC Name | tert-butyl N-benzoyl-N-[6-(bromomethyl)-2-pyridinyl]carbamate;tert-butyl N-benzoyl-N-(6-methyl-2-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)c1ccccc1)c1cccc(CBr)n1.Cc1cccc(N(C(=O)OC(C)(C)C)C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C18H19BrN2O3.C18H20N2O3/c1-18(2,3)24-17(23)21(15-11-7-10-14(12-19)20-15)16(22)13-8-5-4-6-9-13;1-13-9-8-12-15(19-13)20(17(22)23-18(2,3)4)16(21)14-10-6-5-7-11-14/h4-11H,12H2,1-3H3;5-12H,1-4H3 |
| InChIKey | VBKLFJOXYRVNRO-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.63 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|