C26H27IN5O4S- — CID 58454662
5-[4-[dimethylcarbamoyl(methyl)amino]phenyl]iodanuidyl-N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]pyridine-2-carboxamide (PubChem CID 58454662) has the molecular formula C26H27IN5O4S- and a molecular weight of 632.50 g/mol. Its IUPAC name is 5-[4-[dimethylcarbamoyl(methyl)amino]phenyl]iodanuidyl-N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-[4-[dimethylcarbamoyl(methyl)amino]phenyl]iodanuidyl-N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58454662 |
| Molecular Formula | C26H27IN5O4S- |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | 5-[4-[dimethylcarbamoyl(methyl)amino]phenyl]iodanuidyl-N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]pyridine-2-carboxamide |
| SMILES | CCOCOc1ccc2nc(NC(=O)c3ccc([I-]c4ccc(N(C)C(=O)N(C)C)cc4)cn3)sc2c1 |
| InChI | InChI=1S/C26H27IN5O4S/c1-5-35-16-36-20-11-13-21-23(14-20)37-25(29-21)30-24(33)22-12-8-18(15-28-22)27-17-6-9-19(10-7-17)32(4)26(34)31(2)3/h6-15H,5,16H2,1-4H3,(H,29,30,33)/q-1 |
| InChIKey | HKBXVFDYJWQMLG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|