C24H21F3IN3O6S2 — CID 158740350
[6-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]-3-pyridinyl]-(4-methylphenyl)iodanium;trifluoromethanesulfonate (PubChem CID 158740350) has the molecular formula C24H21F3IN3O6S2 and a molecular weight of 695.48 g/mol. Its IUPAC name is [6-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]-3-pyridinyl]-(4-methylphenyl)iodanium;trifluoromethanesulfonate.
| Compound Name | [6-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]-3-pyridinyl]-(4-methylphenyl)iodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158740350 |
| Molecular Formula | C24H21F3IN3O6S2 |
| Molecular Weight | 695.48 g/mol |
| Exact Mass | 694.99 |
| IUPAC Name | [6-[[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]carbamoyl]-3-pyridinyl]-(4-methylphenyl)iodanium;trifluoromethanesulfonate |
| SMILES | CCOCOc1ccc2nc(NC(=O)c3ccc([I+]c4ccc(C)cc4)cn3)sc2c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H20IN3O3S.CHF3O3S/c1-3-29-14-30-18-9-11-19-21(12-18)31-23(26-19)27-22(28)20-10-8-17(13-25-20)24-16-6-4-15(2)5-7-16;2-1(3,4)8(5,6)7/h4-13H,3,14H2,1-2H3;(H,5,6,7) |
| InChIKey | IMFHPWDNNNNHAQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 130.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|