C26H26N2O3S — CID 91239635
N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide (PubChem CID 91239635) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide.
| Compound Name | N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 91239635 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide |
| SMILES | CCOCOc1ccc2nc(NC(=O)c3ccc(CCc4ccc(C)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C26H26N2O3S/c1-3-30-17-31-22-14-15-23-24(16-22)32-26(27-23)28-25(29)21-12-10-20(11-13-21)9-8-19-6-4-18(2)5-7-19/h4-7,10-16H,3,8-9,17H2,1-2H3,(H,27,28,29) |
| InChIKey | VHEYGQADWZZDJJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|