C24H22IN2O4S- — CID 58454712
N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-(4-methoxyphenyl)iodanuidylbenzamide (PubChem CID 58454712) has the molecular formula C24H22IN2O4S- and a molecular weight of 561.42 g/mol. Its IUPAC name is N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-(4-methoxyphenyl)iodanuidylbenzamide.
| Compound Name | N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-(4-methoxyphenyl)iodanuidylbenzamide |
|---|---|
| PubChem CID | 58454712 |
| Molecular Formula | C24H22IN2O4S- |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-(4-methoxyphenyl)iodanuidylbenzamide |
| SMILES | CCOCOc1ccc2nc(NC(=O)c3cccc([I-]c4ccc(OC)cc4)c3)sc2c1 |
| InChI | InChI=1S/C24H22IN2O4S/c1-3-30-15-31-20-11-12-21-22(14-20)32-24(26-21)27-23(28)16-5-4-6-18(13-16)25-17-7-9-19(29-2)10-8-17/h4-14H,3,15H2,1-2H3,(H,26,27,28)/q-1 |
| InChIKey | AZSHFKBQBGBDBX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|