C26H26N2O4S — CID 90828040
N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-[1-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 90828040) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-[1-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-[1-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 90828040 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[6-(ethoxymethoxy)-1,3-benzothiazol-2-yl]-3-[1-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | CCOCOc1ccc2nc(NC(=O)c3cccc(C(C)c4ccc(OC)cc4)c3)sc2c1 |
| InChI | InChI=1S/C26H26N2O4S/c1-4-31-16-32-22-12-13-23-24(15-22)33-26(27-23)28-25(29)20-7-5-6-19(14-20)17(2)18-8-10-21(30-3)11-9-18/h5-15,17H,4,16H2,1-3H3,(H,27,28,29) |
| InChIKey | FCSZFSHRGXQBOA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|