C19H19NO3S — CID 89482246
methyl 4-[6-(1-hydroxybutyl)-1,3-benzothiazol-2-yl]benzoate (PubChem CID 89482246) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl 4-[6-(1-hydroxybutyl)-1,3-benzothiazol-2-yl]benzoate.
| Compound Name | methyl 4-[6-(1-hydroxybutyl)-1,3-benzothiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 89482246 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | methyl 4-[6-(1-hydroxybutyl)-1,3-benzothiazol-2-yl]benzoate |
| SMILES | CCCC(O)c1ccc2nc(-c3ccc(C(=O)OC)cc3)sc2c1 |
| InChI | InChI=1S/C19H19NO3S/c1-3-4-16(21)14-9-10-15-17(11-14)24-18(20-15)12-5-7-13(8-6-12)19(22)23-2/h5-11,16,21H,3-4H2,1-2H3 |
| InChIKey | GKGCSWOVRQOTPJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |