C16H14N2O2S2 — CID 155564568
methyl 4-[(2-amino-1,3-benzothiazol-6-yl)sulfanylmethyl]benzoate (PubChem CID 155564568) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl 4-[(2-amino-1,3-benzothiazol-6-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(2-amino-1,3-benzothiazol-6-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 155564568 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl 4-[(2-amino-1,3-benzothiazol-6-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2ccc3nc(N)sc3c2)cc1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-20-15(19)11-4-2-10(3-5-11)9-21-12-6-7-13-14(8-12)22-16(17)18-13/h2-8H,9H2,1H3,(H2,17,18) |
| InChIKey | CJRBTBVFIXNQRL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |