C11H13N3O2S — CID 164572058
ethyl 2-amino-1,3-benzothiazole-6-carboxylate;methanimine (PubChem CID 164572058) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is ethyl 2-amino-1,3-benzothiazole-6-carboxylate;methanimine.
| Compound Name | ethyl 2-amino-1,3-benzothiazole-6-carboxylate;methanimine |
|---|---|
| PubChem CID | 164572058 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | ethyl 2-amino-1,3-benzothiazole-6-carboxylate;methanimine |
| SMILES | CCOC(=O)c1ccc2nc(N)sc2c1.[H]N=C |
| InChI | InChI=1S/C10H10N2O2S.CH3N/c1-2-14-9(13)6-3-4-7-8(5-6)15-10(11)12-7;1-2/h3-5H,2H2,1H3,(H2,11,12);2H,1H2 |
| InChIKey | NFMFPMHOIUCJMK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|