C15H18N2O2S — CID 65348825
(4-methylcyclohexyl) 2-amino-1,3-benzothiazole-6-carboxylate (PubChem CID 65348825) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (4-methylcyclohexyl) 2-amino-1,3-benzothiazole-6-carboxylate.
| Compound Name | (4-methylcyclohexyl) 2-amino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 65348825 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (4-methylcyclohexyl) 2-amino-1,3-benzothiazole-6-carboxylate |
| SMILES | CC1CCC(OC(=O)c2ccc3nc(N)sc3c2)CC1 |
| InChI | InChI=1S/C15H18N2O2S/c1-9-2-5-11(6-3-9)19-14(18)10-4-7-12-13(8-10)20-15(16)17-12/h4,7-9,11H,2-3,5-6H2,1H3,(H2,16,17) |
| InChIKey | HFNIGCYVXDYAAJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |