C16H12ClNO2S — CID 95930233
ethyl 2-(2-chlorophenyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 95930233) has the molecular formula C16H12ClNO2S and a molecular weight of 317.80 g/mol. Its IUPAC name is ethyl 2-(2-chlorophenyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(2-chlorophenyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 95930233 |
| Molecular Formula | C16H12ClNO2S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | ethyl 2-(2-chlorophenyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(-c3ccccc3Cl)sc2c1 |
| InChI | InChI=1S/C16H12ClNO2S/c1-2-20-16(19)10-7-8-13-14(9-10)21-15(18-13)11-5-3-4-6-12(11)17/h3-9H,2H2,1H3 |
| InChIKey | FAPUOFDJKYQFLJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |