C15H13ClN2OS — CID 82190045
2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine (PubChem CID 82190045) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine.
| Compound Name | 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 82190045 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine |
| SMILES | NCCOc1ccc2nc(-c3ccccc3Cl)sc2c1 |
| InChI | InChI=1S/C15H13ClN2OS/c16-12-4-2-1-3-11(12)15-18-13-6-5-10(19-8-7-17)9-14(13)20-15/h1-6,9H,7-8,17H2 |
| InChIKey | WFKPPPGUCHQOPY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |