About 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine
2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine (PubChem CID 82190045) has the molecular formula C15H13ClN2OS
and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine.
Molecular Properties
| Compound Name | 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine |
| PubChem CID | 82190045 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine |
| SMILES | NCCOc1ccc2nc(-c3ccccc3Cl)sc2c1 |
| InChI | InChI=1S/C15H13ClN2OS/c16-12-4-2-1-3-11(12)15-18-13-6-5-10(19-8-7-17)9-14(13)20-15/h1-6,9H,7-8,17H2 |
| InChIKey | WFKPPPGUCHQOPY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine?
The IUPAC name of 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine (CID 82190045) is 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine.
What is the SMILES notation for 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine?
The canonical SMILES for 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine is NCCOc1ccc2nc(-c3ccccc3Cl)sc2c1.
What is the InChIKey of 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine?
The InChIKey is WFKPPPGUCHQOPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2OS/c16-12-4-2-1-3-11(12)15-18-13-6-5-10(19-8-7-17)9-14(13)20-15/h1-6,9H,7-8,17H2.
What are the key properties of 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine?
2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine has a molecular weight of 304.80 g/mol, XLogP of 3.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2-chlorophenyl)-1,3-benzothiazol-6-yl]oxy]ethanamine is sourced from PubChem (CID 82190045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).