C20H21ClN2O3S — CID 171476890
7-[4-(1,3-benzothiazol-2-yl)-3-chlorophenoxy]-N-hydroxyheptanamide (PubChem CID 171476890) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is 7-[4-(1,3-benzothiazol-2-yl)-3-chlorophenoxy]-N-hydroxyheptanamide.
| Compound Name | 7-[4-(1,3-benzothiazol-2-yl)-3-chlorophenoxy]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 171476890 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 7-[4-(1,3-benzothiazol-2-yl)-3-chlorophenoxy]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCOc1ccc(-c2nc3ccccc3s2)c(Cl)c1)NO |
| InChI | InChI=1S/C20H21ClN2O3S/c21-16-13-14(26-12-6-2-1-3-9-19(24)23-25)10-11-15(16)20-22-17-7-4-5-8-18(17)27-20/h4-5,7-8,10-11,13,25H,1-3,6,9,12H2,(H,23,24) |
| InChIKey | XQTVOXMEJYOBJL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|