C13H15N4O2S+ — CID 4747020
methyl 4-[(4,6-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]benzoate (PubChem CID 4747020) has the molecular formula C13H15N4O2S+ and a molecular weight of 291.36 g/mol. Its IUPAC name is methyl 4-[(4,6-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[(4,6-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 4747020 |
| Molecular Formula | C13H15N4O2S+ |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | methyl 4-[(4,6-diaminopyrimidin-1-ium-2-yl)sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nc(N)cc(N)[nH+]2)cc1 |
| InChI | InChI=1S/C13H14N4O2S/c1-19-12(18)9-4-2-8(3-5-9)7-20-13-16-10(14)6-11(15)17-13/h2-6H,7H2,1H3,(H4,14,15,16,17)/p+1 |
| InChIKey | LGOUGJBIFOBRRV-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 105.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |