methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate

C15H11NO3S — CID 58138527

IUPACmethyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate
SMILESCOC(=O)c1cccc(-c2nc3ccc(O)cc3s2)c1
InChIInChI=1S/C15H11NO3S/c1-19-15(18)10-4-2-3-9(7-10)14-16-12-6-5-11(17)8-13(12)20-14/h2-8,17H,1H3
InChIKeyJQHPLSRNIRTNGY-UHFFFAOYSA-N
MW285.32 g/mol
LogP3.46
Rot. Bonds2

About methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate

methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate (PubChem CID 58138527) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate.

Molecular Properties

Compound Namemethyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate
PubChem CID58138527
Molecular FormulaC15H11NO3S
Molecular Weight285.32 g/mol
Exact Mass285.05
IUPAC Namemethyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate
SMILESCOC(=O)c1cccc(-c2nc3ccc(O)cc3s2)c1
InChIInChI=1S/C15H11NO3S/c1-19-15(18)10-4-2-3-9(7-10)14-16-12-6-5-11(17)8-13(12)20-14/h2-8,17H,1H3
InChIKeyJQHPLSRNIRTNGY-UHFFFAOYSA-N
XLogP3.46
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.32
LogP ≤ 53.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate?
The IUPAC name of methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate (CID 58138527) is methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate.
What is the SMILES notation for methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate?
The canonical SMILES for methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate is COC(=O)c1cccc(-c2nc3ccc(O)cc3s2)c1.
What is the InChIKey of methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate?
The InChIKey is JQHPLSRNIRTNGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO3S/c1-19-15(18)10-4-2-3-9(7-10)14-16-12-6-5-11(17)8-13(12)20-14/h2-8,17H,1H3.
What are the key properties of methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate?
methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate has a molecular weight of 285.32 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate is sourced from PubChem (CID 58138527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).