C15H11NO3S — CID 58138527
methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate (PubChem CID 58138527) has the molecular formula C15H11NO3S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate.
| Compound Name | methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 58138527 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | methyl 3-(6-hydroxy-1,3-benzothiazol-2-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2nc3ccc(O)cc3s2)c1 |
| InChI | InChI=1S/C15H11NO3S/c1-19-15(18)10-4-2-3-9(7-10)14-16-12-6-5-11(17)8-13(12)20-14/h2-8,17H,1H3 |
| InChIKey | JQHPLSRNIRTNGY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |