C14H7ClFNOS — CID 95930246
2-(3-fluorophenyl)-1,3-benzothiazole-6-carbonyl chloride (PubChem CID 95930246) has the molecular formula C14H7ClFNOS and a molecular weight of 291.73 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1,3-benzothiazole-6-carbonyl chloride.
| Compound Name | 2-(3-fluorophenyl)-1,3-benzothiazole-6-carbonyl chloride |
|---|---|
| PubChem CID | 95930246 |
| Molecular Formula | C14H7ClFNOS |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-(3-fluorophenyl)-1,3-benzothiazole-6-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2nc(-c3cccc(F)c3)sc2c1 |
| InChI | InChI=1S/C14H7ClFNOS/c15-13(18)8-4-5-11-12(7-8)19-14(17-11)9-2-1-3-10(16)6-9/h1-7H |
| InChIKey | PQNBBVRJGUSDNW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|