C14H6Cl3NOS — CID 20556656
4-(5,6-dichloro-1,3-benzothiazol-2-yl)benzoyl chloride (PubChem CID 20556656) has the molecular formula C14H6Cl3NOS and a molecular weight of 342.63 g/mol. Its IUPAC name is 4-(5,6-dichloro-1,3-benzothiazol-2-yl)benzoyl chloride.
| Compound Name | 4-(5,6-dichloro-1,3-benzothiazol-2-yl)benzoyl chloride |
|---|---|
| PubChem CID | 20556656 |
| Molecular Formula | C14H6Cl3NOS |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 340.92 |
| IUPAC Name | 4-(5,6-dichloro-1,3-benzothiazol-2-yl)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(-c2nc3cc(Cl)c(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C14H6Cl3NOS/c15-9-5-11-12(6-10(9)16)20-14(18-11)8-3-1-7(2-4-8)13(17)19/h1-6H |
| InChIKey | IHBXOJSNDFSYME-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|