C13H6BrClN2OS — CID 95909714
2-(5-bromo-3-pyridinyl)-1,3-benzothiazole-6-carbonyl chloride (PubChem CID 95909714) has the molecular formula C13H6BrClN2OS and a molecular weight of 353.63 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1,3-benzothiazole-6-carbonyl chloride.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1,3-benzothiazole-6-carbonyl chloride |
|---|---|
| PubChem CID | 95909714 |
| Molecular Formula | C13H6BrClN2OS |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1,3-benzothiazole-6-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2nc(-c3cncc(Br)c3)sc2c1 |
| InChI | InChI=1S/C13H6BrClN2OS/c14-9-3-8(5-16-6-9)13-17-10-2-1-7(12(15)18)4-11(10)19-13/h1-6H |
| InChIKey | WAFSTJXHRMFWJW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|