C15H11ClN2O2S — CID 10567607
N-[2-chloro-4-(6-hydroxy-1,3-benzothiazol-2-yl)phenyl]acetamide (PubChem CID 10567607) has the molecular formula C15H11ClN2O2S and a molecular weight of 318.79 g/mol. Its IUPAC name is N-[2-chloro-4-(6-hydroxy-1,3-benzothiazol-2-yl)phenyl]acetamide.
| Compound Name | N-[2-chloro-4-(6-hydroxy-1,3-benzothiazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 10567607 |
| Molecular Formula | C15H11ClN2O2S |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-[2-chloro-4-(6-hydroxy-1,3-benzothiazol-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2nc3ccc(O)cc3s2)cc1Cl |
| InChI | InChI=1S/C15H11ClN2O2S/c1-8(19)17-12-4-2-9(6-11(12)16)15-18-13-5-3-10(20)7-14(13)21-15/h2-7,20H,1H3,(H,17,19) |
| InChIKey | NZCWYKALTMQUDT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |