C15H14BFN2OS — CID 143210507
2-[3-[fluoro(methyl)boranyl]-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol (PubChem CID 143210507) has the molecular formula C15H14BFN2OS and a molecular weight of 300.17 g/mol. Its IUPAC name is 2-[3-[fluoro(methyl)boranyl]-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol.
| Compound Name | 2-[3-[fluoro(methyl)boranyl]-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 143210507 |
| Molecular Formula | C15H14BFN2OS |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[3-[fluoro(methyl)boranyl]-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol |
| SMILES | CNc1ccc(-c2nc3ccc(O)cc3s2)cc1B(C)F |
| InChI | InChI=1S/C15H14BFN2OS/c1-16(17)11-7-9(3-5-12(11)18-2)15-19-13-6-4-10(20)8-14(13)21-15/h3-8,18,20H,1-2H3 |
| InChIKey | QCSYOGGQQDDGIV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|