C20H26N2O5S2 — CID 91334389
2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate (PubChem CID 91334389) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate.
| Compound Name | 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate |
|---|---|
| PubChem CID | 91334389 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate |
| SMILES | CCCOCCOS(C)(=O)=O.CNc1ccc(-c2nc3ccc(O)cc3s2)cc1 |
| InChI | InChI=1S/C14H12N2OS.C6H14O4S/c1-15-10-4-2-9(3-5-10)14-16-12-7-6-11(17)8-13(12)18-14;1-3-4-9-5-6-10-11(2,7)8/h2-8,15,17H,1H3;3-6H2,1-2H3 |
| InChIKey | ZIJRPBFAOWJKKI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|