About 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate
2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate (PubChem CID 91334389) has the molecular formula C20H26N2O5S2
and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate |
| PubChem CID | 91334389 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate |
| SMILES | CCCOCCOS(C)(=O)=O.CNc1ccc(-c2nc3ccc(O)cc3s2)cc1 |
| InChI | InChI=1S/C14H12N2OS.C6H14O4S/c1-15-10-4-2-9(3-5-10)14-16-12-7-6-11(17)8-13(12)18-14;1-3-4-9-5-6-10-11(2,7)8/h2-8,15,17H,1H3;3-6H2,1-2H3 |
| InChIKey | ZIJRPBFAOWJKKI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate?
The IUPAC name of 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate (CID 91334389) is 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate.
What is the SMILES notation for 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate?
The canonical SMILES for 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate is CCCOCCOS(C)(=O)=O.CNc1ccc(-c2nc3ccc(O)cc3s2)cc1.
What is the InChIKey of 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate?
The InChIKey is ZIJRPBFAOWJKKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2OS.C6H14O4S/c1-15-10-4-2-9(3-5-10)14-16-12-7-6-11(17)8-13(12)18-14;1-3-4-9-5-6-10-11(2,7)8/h2-8,15,17H,1H3;3-6H2,1-2H3.
What are the key properties of 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate?
2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate has a molecular weight of 438.57 g/mol, XLogP of 4.10, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-ol;2-propoxyethyl methanesulfonate is sourced from PubChem (CID 91334389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).