C28H37N3O5S — CID 162522034
2-cyclopentyl-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide (PubChem CID 162522034) has the molecular formula C28H37N3O5S and a molecular weight of 527.69 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 162522034 |
| Molecular Formula | C28H37N3O5S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 2-cyclopentyl-N-[2-[2-[2-[2-[4-(6-hydroxy-1,3-benzothiazol-2-yl)anilino]ethoxy]ethoxy]ethoxy]ethyl]acetamide |
| SMILES | O=C(CC1CCCC1)NCCOCCOCCOCCNc1ccc(-c2nc3ccc(O)cc3s2)cc1 |
| InChI | InChI=1S/C28H37N3O5S/c32-24-9-10-25-26(20-24)37-28(31-25)22-5-7-23(8-6-22)29-11-13-34-15-17-36-18-16-35-14-12-30-27(33)19-21-3-1-2-4-21/h5-10,20-21,29,32H,1-4,11-19H2,(H,30,33) |
| InChIKey | RJCPYVUIVFSEEA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|