C26H26FN3O3S — CID 152974132
2-[4-[(E)-2-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethylamino]-3-pyridinyl]ethenyl]phenyl]-1,3-benzothiazol-6-ol (PubChem CID 152974132) has the molecular formula C26H26FN3O3S and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[4-[(E)-2-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethylamino]-3-pyridinyl]ethenyl]phenyl]-1,3-benzothiazol-6-ol.
| Compound Name | 2-[4-[(E)-2-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethylamino]-3-pyridinyl]ethenyl]phenyl]-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 152974132 |
| Molecular Formula | C26H26FN3O3S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[4-[(E)-2-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethylamino]-3-pyridinyl]ethenyl]phenyl]-1,3-benzothiazol-6-ol |
| SMILES | Oc1ccc2nc(-c3ccc(/C=C/c4ccc(NCCOCCOCCF)nc4)cc3)sc2c1 |
| InChI | InChI=1S/C26H26FN3O3S/c27-11-13-32-15-16-33-14-12-28-25-10-5-20(18-29-25)2-1-19-3-6-21(7-4-19)26-30-23-9-8-22(31)17-24(23)34-26/h1-10,17-18,31H,11-16H2,(H,28,29)/b2-1+ |
| InChIKey | UTBJWKSABRJPLO-OWOJBTEDSA-N |
| XLogP | 5.65 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|