C20H20BrFN2O2S — CID 172603568
2-bromo-4-[(E)-2-[6-[2-(2-fluoroethoxy)ethylamino]-5-methyl-1,3-benzothiazol-2-yl]ethenyl]phenol (PubChem CID 172603568) has the molecular formula C20H20BrFN2O2S and a molecular weight of 451.36 g/mol. Its IUPAC name is 2-bromo-4-[(E)-2-[6-[2-(2-fluoroethoxy)ethylamino]-5-methyl-1,3-benzothiazol-2-yl]ethenyl]phenol.
| Compound Name | 2-bromo-4-[(E)-2-[6-[2-(2-fluoroethoxy)ethylamino]-5-methyl-1,3-benzothiazol-2-yl]ethenyl]phenol |
|---|---|
| PubChem CID | 172603568 |
| Molecular Formula | C20H20BrFN2O2S |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 2-bromo-4-[(E)-2-[6-[2-(2-fluoroethoxy)ethylamino]-5-methyl-1,3-benzothiazol-2-yl]ethenyl]phenol |
| SMILES | Cc1cc2nc(/C=C/c3ccc(O)c(Br)c3)sc2cc1NCCOCCF |
| InChI | InChI=1S/C20H20BrFN2O2S/c1-13-10-17-19(12-16(13)23-7-9-26-8-6-22)27-20(24-17)5-3-14-2-4-18(25)15(21)11-14/h2-5,10-12,23,25H,6-9H2,1H3/b5-3+ |
| InChIKey | XRXLMMRIUIEFGK-HWKANZROSA-N |
| XLogP | 5.64 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|