C22H24N2O3S — CID 123386577
3-[4-[4-(5,6-dimethoxy-1,3-benzothiazol-2-yl)buta-1,3-dienyl]anilino]propan-1-ol (PubChem CID 123386577) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-[4-[4-(5,6-dimethoxy-1,3-benzothiazol-2-yl)buta-1,3-dienyl]anilino]propan-1-ol.
| Compound Name | 3-[4-[4-(5,6-dimethoxy-1,3-benzothiazol-2-yl)buta-1,3-dienyl]anilino]propan-1-ol |
|---|---|
| PubChem CID | 123386577 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-[4-[4-(5,6-dimethoxy-1,3-benzothiazol-2-yl)buta-1,3-dienyl]anilino]propan-1-ol |
| SMILES | COc1cc2nc(C=CC=Cc3ccc(NCCCO)cc3)sc2cc1OC |
| InChI | InChI=1S/C22H24N2O3S/c1-26-19-14-18-21(15-20(19)27-2)28-22(24-18)7-4-3-6-16-8-10-17(11-9-16)23-12-5-13-25/h3-4,6-11,14-15,23,25H,5,12-13H2,1-2H3 |
| InChIKey | UTHNNVUXIYSTSK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|