C40H45FN2O7S — CID 153405872
tert-butyl N-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-N-[6-[(E)-2-[4-[6-(2-methoxyethoxymethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]naphthalen-2-yl]carbamate (PubChem CID 153405872) has the molecular formula C40H45FN2O7S and a molecular weight of 716.87 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-N-[6-[(E)-2-[4-[6-(2-methoxyethoxymethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]naphthalen-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-N-[6-[(E)-2-[4-[6-(2-methoxyethoxymethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]naphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 153405872 |
| Molecular Formula | C40H45FN2O7S |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.29 |
| IUPAC Name | tert-butyl N-[2-[2-(2-fluoroethoxy)ethoxy]ethyl]-N-[6-[(E)-2-[4-[6-(2-methoxyethoxymethoxy)-1,3-benzothiazol-2-yl]phenyl]ethenyl]naphthalen-2-yl]carbamate |
| SMILES | COCCOCOc1ccc2nc(-c3ccc(/C=C/c4ccc5cc(N(CCOCCOCCF)C(=O)OC(C)(C)C)ccc5c4)cc3)sc2c1 |
| InChI | InChI=1S/C40H45FN2O7S/c1-40(2,3)50-39(44)43(18-20-47-24-23-46-19-17-41)34-14-13-32-25-30(9-12-33(32)26-34)6-5-29-7-10-31(11-8-29)38-42-36-16-15-35(27-37(36)51-38)49-28-48-22-21-45-4/h5-16,25-27H,17-24,28H2,1-4H3/b6-5+ |
| InChIKey | PWUVZSPGRWXXGA-AATRIKPKSA-N |
| XLogP | 9.03 |
| TPSA | 88.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|