C24H17F3N2O2S — CID 88927311
2,2,2-trifluoro-N-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]acetamide (PubChem CID 88927311) has the molecular formula C24H17F3N2O2S and a molecular weight of 454.47 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 88927311 |
| Molecular Formula | C24H17F3N2O2S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[(E)-2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]phenyl]acetamide |
| SMILES | COc1ccc2nc(-c3ccc(/C=C/c4ccc(NC(=O)C(F)(F)F)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C24H17F3N2O2S/c1-31-19-12-13-20-21(14-19)32-22(29-20)17-8-4-15(5-9-17)2-3-16-6-10-18(11-7-16)28-23(30)24(25,26)27/h2-14H,1H3,(H,28,30)/b3-2+ |
| InChIKey | SPAODHJIGFBJLE-NSCUHMNNSA-N |
| XLogP | 6.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|