C26H23F3N2OS — CID 174730852
2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(4,4,4-trifluorobutyl)aniline (PubChem CID 174730852) has the molecular formula C26H23F3N2OS and a molecular weight of 468.54 g/mol. Its IUPAC name is 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 174730852 |
| Molecular Formula | C26H23F3N2OS |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)phenyl]ethenyl]-5-(4,4,4-trifluorobutyl)aniline |
| SMILES | COc1ccc2nc(-c3ccc(C=Cc4ccc(CCCC(F)(F)F)cc4N)cc3)sc2c1 |
| InChI | InChI=1S/C26H23F3N2OS/c1-32-21-12-13-23-24(16-21)33-25(31-23)20-10-5-17(6-11-20)4-8-19-9-7-18(15-22(19)30)3-2-14-26(27,28)29/h4-13,15-16H,2-3,14,30H2,1H3 |
| InChIKey | LTQLUMQWMXFLLJ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|