C22H16N2O3S — CID 67237007
6-methoxy-2-[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]-1,3-benzothiazole (PubChem CID 67237007) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 6-methoxy-2-[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 67237007 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 6-methoxy-2-[4-[(E)-2-(3-nitrophenyl)ethenyl]phenyl]-1,3-benzothiazole |
| SMILES | COc1ccc2nc(-c3ccc(/C=C/c4cccc([N+](=O)[O-])c4)cc3)sc2c1 |
| InChI | InChI=1S/C22H16N2O3S/c1-27-19-11-12-20-21(14-19)28-22(23-20)17-9-7-15(8-10-17)5-6-16-3-2-4-18(13-16)24(25)26/h2-14H,1H3/b6-5+ |
| InChIKey | VOONOAJBYVDZTC-AATRIKPKSA-N |
| XLogP | 6.05 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|