C20H13N3O2S — CID 1018484
N-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(3-nitrophenyl)methanimine (PubChem CID 1018484) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(3-nitrophenyl)methanimine.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 1018484 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)phenyl]-1-(3-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(/C=N/c2ccc(-c3nc4ccccc4s3)cc2)c1 |
| InChI | InChI=1S/C20H13N3O2S/c24-23(25)17-5-3-4-14(12-17)13-21-16-10-8-15(9-11-16)20-22-18-6-1-2-7-19(18)26-20/h1-13H/b21-13+ |
| InChIKey | YWQIMDKWQDSVML-FYJGNVAPSA-N |
| XLogP | 5.62 |
| TPSA | 68.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|