C19H11N3O5S — CID 126255565
2-[3-(2,4-dinitrophenoxy)phenyl]-1,3-benzothiazole (PubChem CID 126255565) has the molecular formula C19H11N3O5S and a molecular weight of 393.38 g/mol. Its IUPAC name is 2-[3-(2,4-dinitrophenoxy)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(2,4-dinitrophenoxy)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 126255565 |
| Molecular Formula | C19H11N3O5S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[3-(2,4-dinitrophenoxy)phenyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(-c3nc4ccccc4s3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H11N3O5S/c23-21(24)13-8-9-17(16(11-13)22(25)26)27-14-5-3-4-12(10-14)19-20-15-6-1-2-7-18(15)28-19/h1-11H |
| InChIKey | HSXHLFYTQIIDEY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|