C20H14FN3O2S — CID 134814587
3-(1,3-benzothiazol-2-yl)-N-[(4-fluoro-3-nitrophenyl)methyl]aniline (PubChem CID 134814587) has the molecular formula C20H14FN3O2S and a molecular weight of 379.42 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[(4-fluoro-3-nitrophenyl)methyl]aniline.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[(4-fluoro-3-nitrophenyl)methyl]aniline |
|---|---|
| PubChem CID | 134814587 |
| Molecular Formula | C20H14FN3O2S |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[(4-fluoro-3-nitrophenyl)methyl]aniline |
| SMILES | O=[N+]([O-])c1cc(CNc2cccc(-c3nc4ccccc4s3)c2)ccc1F |
| InChI | InChI=1S/C20H14FN3O2S/c21-16-9-8-13(10-18(16)24(25)26)12-22-15-5-3-4-14(11-15)20-23-17-6-1-2-7-19(17)27-20/h1-11,22H,12H2 |
| InChIKey | AMAHKAUFRLYNSS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|