C20H12FN3O3S — CID 4618088
N-[5-(1,3-benzothiazol-2-yl)-2-nitrophenyl]-2-fluorobenzamide (PubChem CID 4618088) has the molecular formula C20H12FN3O3S and a molecular weight of 393.40 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-nitrophenyl]-2-fluorobenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-nitrophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4618088 |
| Molecular Formula | C20H12FN3O3S |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-nitrophenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cc(-c2nc3ccccc3s2)ccc1[N+](=O)[O-])c1ccccc1F |
| InChI | InChI=1S/C20H12FN3O3S/c21-14-6-2-1-5-13(14)19(25)22-16-11-12(9-10-17(16)24(26)27)20-23-15-7-3-4-8-18(15)28-20/h1-11H,(H,22,25) |
| InChIKey | SERKPAUQKJIASM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|